C17H19IN2S — CID 24761605
(2Z)-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-3,5-dimethyl-1,3-benzothiazole iodide (PubChem CID 24761605) has the molecular formula C17H19IN2S and a molecular weight of 410.32 g/mol. Its IUPAC name is (2Z)-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-3,5-dimethyl-1,3-benzothiazole iodide.
| Compound Name | (2Z)-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-3,5-dimethyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 24761605 |
| Molecular Formula | C17H19IN2S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (2Z)-2-[(1-ethylpyridin-1-ium-2-yl)methylidene]-3,5-dimethyl-1,3-benzothiazole iodide |
| SMILES | CC[n+]1ccccc1/C=C1\Sc2ccc(C)cc2N1C.[I-] |
| InChI | InChI=1S/C17H19N2S.HI/c1-4-19-10-6-5-7-14(19)12-17-18(3)15-11-13(2)8-9-16(15)20-17;/h5-12H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UNSCTEHABQTZJS-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|