C27H36O6 — CID 24764751
3-methylbutyl (1R,2S,9R,10R,11R,14R,15S)-2-methyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-carboxylate (PubChem CID 24764751) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-methylbutyl (1R,2S,9R,10R,11R,14R,15S)-2-methyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-carboxylate.
| Compound Name | 3-methylbutyl (1R,2S,9R,10R,11R,14R,15S)-2-methyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-carboxylate |
|---|---|
| PubChem CID | 24764751 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-methylbutyl (1R,2S,9R,10R,11R,14R,15S)-2-methyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-carboxylate |
| SMILES | CC(C)CCOC(=O)[C@@H]1CC2=CC(=O)CC[C@]2(C)[C@@]23OC2C[C@H]2[C@@H](CC[C@@]24CCC(=O)O4)[C@H]13 |
| InChI | InChI=1S/C27H36O6/c1-15(2)7-11-31-24(30)19-13-16-12-17(28)4-8-25(16,3)27-21(32-27)14-20-18(23(19)27)5-9-26(20)10-6-22(29)33-26/h12,15,18-21,23H,4-11,13-14H2,1-3H3/t18-,19-,20+,21?,23-,25+,26-,27-/m1/s1 |
| InChIKey | RSRWGUPNWNNBBJ-QRWVXIMESA-N |
| XLogP | 4.15 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|