C23H29NO2 — CID 24765128
(5S)-5-[hydroxy-bis(3-propan-2-ylphenyl)methyl]pyrrolidin-2-one (PubChem CID 24765128) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (5S)-5-[hydroxy-bis(3-propan-2-ylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[hydroxy-bis(3-propan-2-ylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 24765128 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (5S)-5-[hydroxy-bis(3-propan-2-ylphenyl)methyl]pyrrolidin-2-one |
| SMILES | CC(C)c1cccc(C(O)(c2cccc(C(C)C)c2)[C@@H]2CCC(=O)N2)c1 |
| InChI | InChI=1S/C23H29NO2/c1-15(2)17-7-5-9-19(13-17)23(26,21-11-12-22(25)24-21)20-10-6-8-18(14-20)16(3)4/h5-10,13-16,21,26H,11-12H2,1-4H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | MMKURNPHSCYKKA-NRFANRHFSA-N |
| XLogP | 4.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |