C22H35NO3S2Si — CID 24767473
(3R)-3-methoxy-3-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]propan-1-one (PubChem CID 24767473) has the molecular formula C22H35NO3S2Si and a molecular weight of 453.75 g/mol. Its IUPAC name is (3R)-3-methoxy-3-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]propan-1-one.
| Compound Name | (3R)-3-methoxy-3-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 24767473 |
| Molecular Formula | C22H35NO3S2Si |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (3R)-3-methoxy-3-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]propan-1-one |
| SMILES | CC[Si](CC)(CC)OC(C)(C)[C@@H]1CSC(=S)N1C(=O)C[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C22H35NO3S2Si/c1-7-29(8-2,9-3)26-22(4,5)19-16-28-21(27)23(19)20(24)15-18(25-6)17-13-11-10-12-14-17/h10-14,18-19H,7-9,15-16H2,1-6H3/t18-,19+/m1/s1 |
| InChIKey | RPAGKIQKZRHFNC-MOPGFXCFSA-N |
| XLogP | 5.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|