C29H30O4 — CID 24769812
(2S,3S,4S)-2-ethenyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane (PubChem CID 24769812) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2S,3S,4S)-2-ethenyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane.
| Compound Name | (2S,3S,4S)-2-ethenyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 24769812 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2S,3S,4S)-2-ethenyl-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane |
| SMILES | C=C[C@@]1(COCc2ccccc2)OC(=C)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H30O4/c1-3-29(22-30-19-24-13-7-4-8-14-24)28(32-21-26-17-11-6-12-18-26)27(23(2)33-29)31-20-25-15-9-5-10-16-25/h3-18,27-28H,1-2,19-22H2/t27-,28+,29+/m1/s1 |
| InChIKey | KAXDFNNEDSVWIT-ULNSLHSMSA-N |
| XLogP | 5.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|