C37H40O6 — CID 54589661
(2R,3S,4S)-2-methoxy-3,4-bis(phenylmethoxy)-6-(2-phenylmethoxyethyl)-2-(phenylmethoxymethyl)-3,4-dihydropyran (PubChem CID 54589661) has the molecular formula C37H40O6 and a molecular weight of 580.72 g/mol. Its IUPAC name is (2R,3S,4S)-2-methoxy-3,4-bis(phenylmethoxy)-6-(2-phenylmethoxyethyl)-2-(phenylmethoxymethyl)-3,4-dihydropyran.
| Compound Name | (2R,3S,4S)-2-methoxy-3,4-bis(phenylmethoxy)-6-(2-phenylmethoxyethyl)-2-(phenylmethoxymethyl)-3,4-dihydropyran |
|---|---|
| PubChem CID | 54589661 |
| Molecular Formula | C37H40O6 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | (2R,3S,4S)-2-methoxy-3,4-bis(phenylmethoxy)-6-(2-phenylmethoxyethyl)-2-(phenylmethoxymethyl)-3,4-dihydropyran |
| SMILES | CO[C@]1(COCc2ccccc2)OC(CCOCc2ccccc2)=C[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H40O6/c1-38-37(29-40-26-31-16-8-3-9-17-31)36(42-28-33-20-12-5-13-21-33)35(41-27-32-18-10-4-11-19-32)24-34(43-37)22-23-39-25-30-14-6-2-7-15-30/h2-21,24,35-36H,22-23,25-29H2,1H3/t35-,36-,37+/m0/s1 |
| InChIKey | KBAVDBCSJBNJAR-AGSXMJPOSA-N |
| XLogP | 7.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|