C9H15NO — CID 24772962
1-(4-methoxycyclohexa-1,4-dien-1-yl)-N-methylmethanamine (PubChem CID 24772962) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-(4-methoxycyclohexa-1,4-dien-1-yl)-N-methylmethanamine.
| Compound Name | 1-(4-methoxycyclohexa-1,4-dien-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 24772962 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-(4-methoxycyclohexa-1,4-dien-1-yl)-N-methylmethanamine |
| SMILES | CNCC1=CCC(OC)=CC1 |
| InChI | InChI=1S/C9H15NO/c1-10-7-8-3-5-9(11-2)6-4-8/h3,6,10H,4-5,7H2,1-2H3 |
| InChIKey | GMGMMEPQEUSUOQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|