C23H23BrF2N2O2 — CID 24774710
(3S)-3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-(2,4-difluorophenyl)piperidine-2,6-dione (PubChem CID 24774710) has the molecular formula C23H23BrF2N2O2 and a molecular weight of 477.35 g/mol. Its IUPAC name is (3S)-3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-(2,4-difluorophenyl)piperidine-2,6-dione.
| Compound Name | (3S)-3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-(2,4-difluorophenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 24774710 |
| Molecular Formula | C23H23BrF2N2O2 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | (3S)-3-[1-[(4-bromophenyl)methyl]piperidin-4-yl]-3-(2,4-difluorophenyl)piperidine-2,6-dione |
| SMILES | O=C1CC[C@@](c2ccc(F)cc2F)(C2CCN(Cc3ccc(Br)cc3)CC2)C(=O)N1 |
| InChI | InChI=1S/C23H23BrF2N2O2/c24-17-3-1-15(2-4-17)14-28-11-8-16(9-12-28)23(10-7-21(29)27-22(23)30)19-6-5-18(25)13-20(19)26/h1-6,13,16H,7-12,14H2,(H,27,29,30)/t23-/m0/s1 |
| InChIKey | BJFMBQBPMWUGFF-QHCPKHFHSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|