C27H21F10NO3 — CID 24774923
1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol (PubChem CID 24774923) has the molecular formula C27H21F10NO3 and a molecular weight of 597.45 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 24774923 |
| Molecular Formula | C27H21F10NO3 |
| Molecular Weight | 597.45 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
| SMILES | OC(CN1c2cccc(-c3ccc(OC(F)(F)F)cc3)c2CCC1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C27H21F10NO3/c28-24(29)26(33,34)40-18-4-1-3-16(13-18)21-12-11-20-19(15-7-9-17(10-8-15)41-27(35,36)37)5-2-6-22(20)38(21)14-23(39)25(30,31)32/h1-10,13,21,23-24,39H,11-12,14H2 |
| InChIKey | CJGFLSMKDCVJOR-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.45 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|