C27H26N2O — CID 24775931
3-(4-cyanophenyl)-N-(4-cyclohexylphenyl)-4-methylbenzamide (PubChem CID 24775931) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-(4-cyclohexylphenyl)-4-methylbenzamide.
| Compound Name | 3-(4-cyanophenyl)-N-(4-cyclohexylphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 24775931 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 3-(4-cyanophenyl)-N-(4-cyclohexylphenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C3CCCCC3)cc2)cc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H26N2O/c1-19-7-10-24(17-26(19)23-11-8-20(18-28)9-12-23)27(30)29-25-15-13-22(14-16-25)21-5-3-2-4-6-21/h7-17,21H,2-6H2,1H3,(H,29,30) |
| InChIKey | WISFQSHSRVFDOH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |