C17H20N2S — CID 24776191
methyl N'-(2,2-diphenylpropyl)carbamimidothioate (PubChem CID 24776191) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is methyl N'-(2,2-diphenylpropyl)carbamimidothioate.
| Compound Name | methyl N'-(2,2-diphenylpropyl)carbamimidothioate |
|---|---|
| PubChem CID | 24776191 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | methyl N'-(2,2-diphenylpropyl)carbamimidothioate |
| SMILES | CS/C(N)=N\CC(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2S/c1-17(13-19-16(18)20-2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H2,18,19) |
| InChIKey | OINXKJUSSMMXFE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|