C17H16Cl2N6 — CID 24777302
9-butyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile (PubChem CID 24777302) has the molecular formula C17H16Cl2N6 and a molecular weight of 375.26 g/mol. Its IUPAC name is 9-butyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile.
| Compound Name | 9-butyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile |
|---|---|
| PubChem CID | 24777302 |
| Molecular Formula | C17H16Cl2N6 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 9-butyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile |
| SMILES | CCCCn1cnc2c(NCc3ccc(Cl)c(Cl)c3)nc(C#N)nc21 |
| InChI | InChI=1S/C17H16Cl2N6/c1-2-3-6-25-10-22-15-16(23-14(8-20)24-17(15)25)21-9-11-4-5-12(18)13(19)7-11/h4-5,7,10H,2-3,6,9H2,1H3,(H,21,23,24) |
| InChIKey | FSQIUURXINGUNK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |