C29H33F3N6O — CID 24782639
2-(1-cyclopropylethoxy)-N-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 24782639) has the molecular formula C29H33F3N6O and a molecular weight of 538.62 g/mol. Its IUPAC name is 2-(1-cyclopropylethoxy)-N-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-(1-cyclopropylethoxy)-N-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 24782639 |
| Molecular Formula | C29H33F3N6O |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-(1-cyclopropylethoxy)-N-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | CC(Oc1nc2c(c(Nc3ccc4c(c3)N(C)CCC4)n1)CCN(c1ncccc1C(F)(F)F)CC2)C1CC1 |
| InChI | InChI=1S/C29H33F3N6O/c1-18(19-7-8-19)39-28-35-24-12-16-38(27-23(29(30,31)32)6-3-13-33-27)15-11-22(24)26(36-28)34-21-10-9-20-5-4-14-37(2)25(20)17-21/h3,6,9-10,13,17-19H,4-5,7-8,11-12,14-16H2,1-2H3,(H,34,35,36) |
| InChIKey | SAOXCZNWKZLAGT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |