C27H31F3N6 — CID 90107308
N-(3,4-dimethylphenyl)-2-piperidin-1-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 90107308) has the molecular formula C27H31F3N6 and a molecular weight of 496.58 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-piperidin-1-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-(3,4-dimethylphenyl)-2-piperidin-1-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 90107308 |
| Molecular Formula | C27H31F3N6 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-piperidin-1-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | Cc1ccc(Nc2nc(N3CCCCC3)nc3c2CCN(c2ncccc2C(F)(F)F)CC3)cc1C |
| InChI | InChI=1S/C27H31F3N6/c1-18-8-9-20(17-19(18)2)32-24-21-10-15-35(25-22(27(28,29)30)7-6-12-31-25)16-11-23(21)33-26(34-24)36-13-4-3-5-14-36/h6-9,12,17H,3-5,10-11,13-16H2,1-2H3,(H,32,33,34) |
| InChIKey | WPNJXNQHCAYCDH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |