C25H26F6N6O2S — CID 24785423
2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 24785423) has the molecular formula C25H26F6N6O2S and a molecular weight of 588.58 g/mol. Its IUPAC name is 2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 24785423 |
| Molecular Formula | C25H26F6N6O2S |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | OS1(O)CCN(c2nc3c(c(Nc4ccc(C(F)(F)F)cc4)n2)CCN(c2ncccc2C(F)(F)F)CC3)CC1 |
| InChI | InChI=1S/C25H26F6N6O2S/c26-24(27,28)16-3-5-17(6-4-16)33-21-18-7-10-36(22-19(25(29,30)31)2-1-9-32-22)11-8-20(18)34-23(35-21)37-12-14-40(38,39)15-13-37/h1-6,9,38-39H,7-8,10-15H2,(H,33,34,35) |
| InChIKey | NNSVEWSKBLYRCZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |