C29H35F6N7 — CID 143545547
ethane;2-piperazin-1-yl-N-[4-(trifluoromethyl)phenyl]-9-[3-(trifluoromethyl)-2-pyridinyl]-5,6,7,8,10,11-hexahydropyrimido[4,5-d]azonin-4-amine (PubChem CID 143545547) has the molecular formula C29H35F6N7 and a molecular weight of 595.64 g/mol. Its IUPAC name is ethane;2-piperazin-1-yl-N-[4-(trifluoromethyl)phenyl]-9-[3-(trifluoromethyl)-2-pyridinyl]-5,6,7,8,10,11-hexahydropyrimido[4,5-d]azonin-4-amine.
| Compound Name | ethane;2-piperazin-1-yl-N-[4-(trifluoromethyl)phenyl]-9-[3-(trifluoromethyl)-2-pyridinyl]-5,6,7,8,10,11-hexahydropyrimido[4,5-d]azonin-4-amine |
|---|---|
| PubChem CID | 143545547 |
| Molecular Formula | C29H35F6N7 |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | ethane;2-piperazin-1-yl-N-[4-(trifluoromethyl)phenyl]-9-[3-(trifluoromethyl)-2-pyridinyl]-5,6,7,8,10,11-hexahydropyrimido[4,5-d]azonin-4-amine |
| SMILES | CC.FC(F)(F)c1ccc(Nc2nc(N3CCNCC3)nc3c2CCCCN(c2ncccc2C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C27H29F6N7.C2H6/c28-26(29,30)18-6-8-19(9-7-18)36-23-20-4-1-2-14-39(24-21(27(31,32)33)5-3-11-35-24)15-10-22(20)37-25(38-23)40-16-12-34-13-17-40;1-2/h3,5-9,11,34H,1-2,4,10,12-17H2,(H,36,37,38);1-2H3 |
| InChIKey | KERMYTYGCQAGOW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |