C25H22F8N6 — CID 24785419
2-(3,3-difluoropyrrolidin-1-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 24785419) has the molecular formula C25H22F8N6 and a molecular weight of 558.48 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 24785419 |
| Molecular Formula | C25H22F8N6 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | FC1(F)CCN(c2nc3c(c(Nc4ccc(C(F)(F)F)cc4)n2)CCN(c2ncccc2C(F)(F)F)CC3)C1 |
| InChI | InChI=1S/C25H22F8N6/c26-23(27)9-13-39(14-23)22-36-19-8-12-38(21-18(25(31,32)33)2-1-10-34-21)11-7-17(19)20(37-22)35-16-5-3-15(4-6-16)24(28,29)30/h1-6,10H,7-9,11-14H2,(H,35,36,37) |
| InChIKey | MBPGQULKKFYHTN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |