C24H24F6N6O — CID 58972641
2-N-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 58972641) has the molecular formula C24H24F6N6O and a molecular weight of 526.49 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 58972641 |
| Molecular Formula | C24H24F6N6O |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2-N-(2-methoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COCCNc1nc2c(c(Nc3ccc(C(F)(F)F)cc3)n1)CCN(c1ncccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C24H24F6N6O/c1-37-14-11-32-22-34-19-9-13-36(21-18(24(28,29)30)3-2-10-31-21)12-8-17(19)20(35-22)33-16-6-4-15(5-7-16)23(25,26)27/h2-7,10H,8-9,11-14H2,1H3,(H2,32,33,34,35) |
| InChIKey | MSVQYLQJVHJBKW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|