C26H28F6N6O — CID 90126829
2-N-(2-propoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 90126829) has the molecular formula C26H28F6N6O and a molecular weight of 554.54 g/mol. Its IUPAC name is 2-N-(2-propoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 2-N-(2-propoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 90126829 |
| Molecular Formula | C26H28F6N6O |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 2-N-(2-propoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CCCOCCNc1nc2c(c(Nc3ccc(C(F)(F)F)cc3)n1)CCN(c1ncccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C26H28F6N6O/c1-2-15-39-16-12-34-24-36-21-10-14-38(23-20(26(30,31)32)4-3-11-33-23)13-9-19(21)22(37-24)35-18-7-5-17(6-8-18)25(27,28)29/h3-8,11H,2,9-10,12-16H2,1H3,(H2,34,35,36,37) |
| InChIKey | IRLWPUATBJSBBD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|