C29H36F3N7O — CID 11455715
2-[(2-methoxyethylamino)methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 11455715) has the molecular formula C29H36F3N7O and a molecular weight of 555.65 g/mol. Its IUPAC name is 2-[(2-methoxyethylamino)methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-[(2-methoxyethylamino)methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11455715 |
| Molecular Formula | C29H36F3N7O |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 2-[(2-methoxyethylamino)methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | COCCNCc1nc2c(c(Nc3ccc4c(c3)N(C)CCC4(C)C)n1)CCN(c1ncccc1C(F)(F)F)C2 |
| InChI | InChI=1S/C29H36F3N7O/c1-28(2)10-14-38(3)24-16-19(7-8-21(24)28)35-26-20-9-13-39(27-22(29(30,31)32)6-5-11-34-27)18-23(20)36-25(37-26)17-33-12-15-40-4/h5-8,11,16,33H,9-10,12-15,17-18H2,1-4H3,(H,35,36,37) |
| InChIKey | RQFLZVRKDBKHFB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|