C32H40F3N7 — CID 143323485
2-[[2-(2-methylcyclopropyl)ethylamino]methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 143323485) has the molecular formula C32H40F3N7 and a molecular weight of 579.72 g/mol. Its IUPAC name is 2-[[2-(2-methylcyclopropyl)ethylamino]methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-[[2-(2-methylcyclopropyl)ethylamino]methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143323485 |
| Molecular Formula | C32H40F3N7 |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | 2-[[2-(2-methylcyclopropyl)ethylamino]methyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CC1CC1CCNCc1nc2c(c(Nc3ccc4c(c3)N(C)CCC4(C)C)n1)CCN(c1ncccc1C(F)(F)F)C2 |
| InChI | InChI=1S/C32H40F3N7/c1-20-16-21(20)9-13-36-18-28-39-26-19-42(30-25(32(33,34)35)6-5-12-37-30)14-10-23(26)29(40-28)38-22-7-8-24-27(17-22)41(4)15-11-31(24,2)3/h5-8,12,17,20-21,36H,9-11,13-16,18-19H2,1-4H3,(H,38,39,40) |
| InChIKey | WPVQXLIYNROKGE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|