C24H22ClN5O2 — CID 24784198
[2-chloro-5-[[4-cyano-3-(4-cyanophenyl)-2-methyl-5-propylpyrrol-1-yl]methyl]-3-pyridinyl]methyl carbamate (PubChem CID 24784198) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is [2-chloro-5-[[4-cyano-3-(4-cyanophenyl)-2-methyl-5-propylpyrrol-1-yl]methyl]-3-pyridinyl]methyl carbamate.
| Compound Name | [2-chloro-5-[[4-cyano-3-(4-cyanophenyl)-2-methyl-5-propylpyrrol-1-yl]methyl]-3-pyridinyl]methyl carbamate |
|---|---|
| PubChem CID | 24784198 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-chloro-5-[[4-cyano-3-(4-cyanophenyl)-2-methyl-5-propylpyrrol-1-yl]methyl]-3-pyridinyl]methyl carbamate |
| SMILES | CCCc1c(C#N)c(-c2ccc(C#N)cc2)c(C)n1Cc1cnc(Cl)c(COC(N)=O)c1 |
| InChI | InChI=1S/C24H22ClN5O2/c1-3-4-21-20(11-27)22(18-7-5-16(10-26)6-8-18)15(2)30(21)13-17-9-19(14-32-24(28)31)23(25)29-12-17/h5-9,12H,3-4,13-14H2,1-2H3,(H2,28,31) |
| InChIKey | OIGZAMSVMZKDHA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|