C25H22N6O — CID 142260889
but-3-enenitrile;5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]pyridine-2-carboxamide (PubChem CID 142260889) has the molecular formula C25H22N6O and a molecular weight of 422.49 g/mol. Its IUPAC name is but-3-enenitrile;5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]pyridine-2-carboxamide.
| Compound Name | but-3-enenitrile;5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142260889 |
| Molecular Formula | C25H22N6O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | but-3-enenitrile;5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]pyridine-2-carboxamide |
| SMILES | C=CCC#N.Cc1c(C#N)c(-c2ccc(C#N)cc2)c(C)n1Cc1ccc(C(N)=O)nc1 |
| InChI | InChI=1S/C21H17N5O.C4H5N/c1-13-18(10-23)20(17-6-3-15(9-22)4-7-17)14(2)26(13)12-16-5-8-19(21(24)27)25-11-16;1-2-3-4-5/h3-8,11H,12H2,1-2H3,(H2,24,27);2H,1,3H2 |
| InChIKey | IVZUBQRFKMUPBE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|