C26H20N4O3S — CID 87996725
[5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-2-pyridinyl] benzenesulfonate (PubChem CID 87996725) has the molecular formula C26H20N4O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is [5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-2-pyridinyl] benzenesulfonate.
| Compound Name | [5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-2-pyridinyl] benzenesulfonate |
|---|---|
| PubChem CID | 87996725 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | [5-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-2-pyridinyl] benzenesulfonate |
| SMILES | Cc1c(C#N)c(-c2ccc(C#N)cc2)c(C)n1Cc1ccc(OS(=O)(=O)c2ccccc2)nc1 |
| InChI | InChI=1S/C26H20N4O3S/c1-18-24(15-28)26(22-11-8-20(14-27)9-12-22)19(2)30(18)17-21-10-13-25(29-16-21)33-34(31,32)23-6-4-3-5-7-23/h3-13,16H,17H2,1-2H3 |
| InChIKey | UPQWMSUBBLLMGV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 108.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|