C23H23N3O — CID 3732537
4-(4-cyanophenyl)-5-ethyl-2-methyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxamide (PubChem CID 3732537) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-5-ethyl-2-methyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxamide.
| Compound Name | 4-(4-cyanophenyl)-5-ethyl-2-methyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3732537 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-(4-cyanophenyl)-5-ethyl-2-methyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxamide |
| SMILES | CCc1c(-c2ccc(C#N)cc2)c(C(N)=O)c(C)n1Cc1cccc(C)c1 |
| InChI | InChI=1S/C23H23N3O/c1-4-20-22(19-10-8-17(13-24)9-11-19)21(23(25)27)16(3)26(20)14-18-7-5-6-15(2)12-18/h5-12H,4,14H2,1-3H3,(H2,25,27) |
| InChIKey | LHBFHNUNUGRJKV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |