C20H19N5O2 — CID 89313429
(E)-3-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-4-hydrazinyl-2-methylidenebut-3-enoic acid (PubChem CID 89313429) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is (E)-3-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-4-hydrazinyl-2-methylidenebut-3-enoic acid.
| Compound Name | (E)-3-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-4-hydrazinyl-2-methylidenebut-3-enoic acid |
|---|---|
| PubChem CID | 89313429 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (E)-3-[[3-cyano-4-(4-cyanophenyl)-2,5-dimethylpyrrol-1-yl]methyl]-4-hydrazinyl-2-methylidenebut-3-enoic acid |
| SMILES | C=C(C(=O)O)/C(=C\NN)Cn1c(C)c(C#N)c(-c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C20H19N5O2/c1-12(20(26)27)17(10-24-23)11-25-13(2)18(9-22)19(14(25)3)16-6-4-15(8-21)5-7-16/h4-7,10,24H,1,11,23H2,2-3H3,(H,26,27)/b17-10- |
| InChIKey | WYCDUXXOOQCELL-YVLHZVERSA-N |
| XLogP | 2.50 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|