C11H13F3N3O4W- — CID 24784665
[(2S)-1-[(2S)-2-cyanopyrrolidin-1-yl]-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate;tungsten (PubChem CID 24784665) has the molecular formula C11H13F3N3O4W- and a molecular weight of 492.08 g/mol. Its IUPAC name is [(2S)-1-[(2S)-2-cyanopyrrolidin-1-yl]-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate;tungsten.
| Compound Name | [(2S)-1-[(2S)-2-cyanopyrrolidin-1-yl]-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate;tungsten |
|---|---|
| PubChem CID | 24784665 |
| Molecular Formula | C11H13F3N3O4W- |
| Molecular Weight | 492.08 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | [(2S)-1-[(2S)-2-cyanopyrrolidin-1-yl]-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate;tungsten |
| SMILES | N#C[C@@H]1CCCN1C(=O)[C@@H]([NH3+])C[C-]=O.O=C([O-])C(F)(F)F.[W] |
| InChI | InChI=1S/C9H12N3O2.C2HF3O2.W/c10-6-7-2-1-4-12(7)9(14)8(11)3-5-13;3-2(4,5)1(6)7;/h7-8H,1-4,11H2;(H,6,7);/q-1;;/t7-,8-;;/m0../s1 |
| InChIKey | CSPMFYWTUQQIIB-FOMWZSOGSA-N |
| XLogP | -2.09 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.08 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|