C24H27NO4 — CID 24788110
ethyl 3-[benzoyl(benzyl)carbamoyl]-2,4-dimethylpent-3-enoate (PubChem CID 24788110) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is ethyl 3-[benzoyl(benzyl)carbamoyl]-2,4-dimethylpent-3-enoate.
| Compound Name | ethyl 3-[benzoyl(benzyl)carbamoyl]-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 24788110 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | ethyl 3-[benzoyl(benzyl)carbamoyl]-2,4-dimethylpent-3-enoate |
| SMILES | CCOC(=O)C(C)C(C(=O)N(Cc1ccccc1)C(=O)c1ccccc1)=C(C)C |
| InChI | InChI=1S/C24H27NO4/c1-5-29-24(28)18(4)21(17(2)3)23(27)25(16-19-12-8-6-9-13-19)22(26)20-14-10-7-11-15-20/h6-15,18H,5,16H2,1-4H3 |
| InChIKey | CJKIUTHZUPZOFL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|