C34H46N4O8S — CID 24788898
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(3Z)-3-(diethylaminomethylidene)-2-oxo-1H-indol-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 24788898) has the molecular formula C34H46N4O8S and a molecular weight of 670.83 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(3Z)-3-(diethylaminomethylidene)-2-oxo-1H-indol-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(3Z)-3-(diethylaminomethylidene)-2-oxo-1H-indol-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24788898 |
| Molecular Formula | C34H46N4O8S |
| Molecular Weight | 670.83 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[(3Z)-3-(diethylaminomethylidene)-2-oxo-1H-indol-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCN(/C=C1\C(=O)Nc2ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Cc3ccccc3)NC(=O)OC3COC4OCCC34)cc21)CC |
| InChI | InChI=1S/C34H46N4O8S/c1-5-37(6-2)19-27-26-17-24(12-13-28(26)35-32(27)40)47(42,43)38(18-22(3)4)20-30(39)29(16-23-10-8-7-9-11-23)36-34(41)46-31-21-45-33-25(31)14-15-44-33/h7-13,17,19,22,25,29-31,33,39H,5-6,14-16,18,20-21H2,1-4H3,(H,35,40)(H,36,41)/b27-19- |
| InChIKey | AXBPEUZAQAUXCU-DIBXZPPDSA-N |
| XLogP | 3.43 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|