C37H41N3O10S — CID 69492251
4-[(Z)-[5-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]-2-oxo-1H-indol-3-ylidene]methyl]benzoic acid (PubChem CID 69492251) has the molecular formula C37H41N3O10S and a molecular weight of 719.81 g/mol. Its IUPAC name is 4-[(Z)-[5-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]-2-oxo-1H-indol-3-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[5-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]-2-oxo-1H-indol-3-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 69492251 |
| Molecular Formula | C37H41N3O10S |
| Molecular Weight | 719.81 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | 4-[(Z)-[5-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]-2-oxo-1H-indol-3-ylidene]methyl]benzoic acid |
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc2c(c1)/C(=C/c1ccc(C(=O)O)cc1)C(=O)N2 |
| InChI | InChI=1S/C37H41N3O10S/c1-22(2)19-40(20-32(41)31(17-23-6-4-3-5-7-23)39-37(45)50-33-21-49-36-27(33)14-15-48-36)51(46,47)26-12-13-30-28(18-26)29(34(42)38-30)16-24-8-10-25(11-9-24)35(43)44/h3-13,16,18,22,27,31-33,36,41H,14-15,17,19-21H2,1-2H3,(H,38,42)(H,39,45)(H,43,44)/b29-16- |
| InChIKey | KTULFDHSWBAMAK-MWLSYYOVSA-N |
| XLogP | 3.98 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|