C30H37N3O8S — CID 89366192
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-3-hydroxy-4-[(3-methylidene-2-oxo-1H-indol-5-yl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 89366192) has the molecular formula C30H37N3O8S and a molecular weight of 599.71 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-3-hydroxy-4-[(3-methylidene-2-oxo-1H-indol-5-yl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-3-hydroxy-4-[(3-methylidene-2-oxo-1H-indol-5-yl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89366192 |
| Molecular Formula | C30H37N3O8S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-3-hydroxy-4-[(3-methylidene-2-oxo-1H-indol-5-yl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | C=C1C(=O)Nc2ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)OC3COC4OCCC34)cc21 |
| InChI | InChI=1S/C30H37N3O8S/c1-18(2)15-33(42(37,38)21-9-10-24-23(14-21)19(3)28(35)31-24)16-26(34)25(13-20-7-5-4-6-8-20)32-30(36)41-27-17-40-29-22(27)11-12-39-29/h4-10,14,18,22,25-27,29,34H,3,11-13,15-17H2,1-2H3,(H,31,35)(H,32,36)/t22?,25-,26+,27?,29?/m0/s1 |
| InChIKey | RINJPAVMGWEAOY-NJJRPMSOSA-N |
| XLogP | 2.76 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|