C19H21ClN4O5 — CID 24789896
N-[5-[(5-chloro-3-pyridinyl)oxy]-2,4-dinitrophenyl]cyclooctanamine (PubChem CID 24789896) has the molecular formula C19H21ClN4O5 and a molecular weight of 420.85 g/mol. Its IUPAC name is N-[5-[(5-chloro-3-pyridinyl)oxy]-2,4-dinitrophenyl]cyclooctanamine.
| Compound Name | N-[5-[(5-chloro-3-pyridinyl)oxy]-2,4-dinitrophenyl]cyclooctanamine |
|---|---|
| PubChem CID | 24789896 |
| Molecular Formula | C19H21ClN4O5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[5-[(5-chloro-3-pyridinyl)oxy]-2,4-dinitrophenyl]cyclooctanamine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Oc2cncc(Cl)c2)cc1NC1CCCCCCC1 |
| InChI | InChI=1S/C19H21ClN4O5/c20-13-8-15(12-21-11-13)29-19-9-16(17(23(25)26)10-18(19)24(27)28)22-14-6-4-2-1-3-5-7-14/h8-12,14,22H,1-7H2 |
| InChIKey | IEXCUFMFDXXMAR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|