C27H35N3O3 — CID 24791404
methyl 2-[(1-cyclohexylpiperidin-3-yl)methyl-(pyridin-3-ylmethyl)carbamoyl]benzoate (PubChem CID 24791404) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is methyl 2-[(1-cyclohexylpiperidin-3-yl)methyl-(pyridin-3-ylmethyl)carbamoyl]benzoate.
| Compound Name | methyl 2-[(1-cyclohexylpiperidin-3-yl)methyl-(pyridin-3-ylmethyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 24791404 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | methyl 2-[(1-cyclohexylpiperidin-3-yl)methyl-(pyridin-3-ylmethyl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)N(Cc1cccnc1)CC1CCCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C27H35N3O3/c1-33-27(32)25-14-6-5-13-24(25)26(31)30(18-21-9-7-15-28-17-21)20-22-10-8-16-29(19-22)23-11-3-2-4-12-23/h5-7,9,13-15,17,22-23H,2-4,8,10-12,16,18-20H2,1H3 |
| InChIKey | JTQKIDONFQCFAT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |