C21H28FN5O — CID 24791424
1-[3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylpyrazol-1-yl)ethanone (PubChem CID 24791424) has the molecular formula C21H28FN5O and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylpyrazol-1-yl)ethanone.
| Compound Name | 1-[3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 24791424 |
| Molecular Formula | C21H28FN5O |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-[3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylpyrazol-1-yl)ethanone |
| SMILES | Cc1ccn(CC(=O)N2CCCC(N3CCN(c4ccccc4F)CC3)C2)n1 |
| InChI | InChI=1S/C21H28FN5O/c1-17-8-10-27(23-17)16-21(28)26-9-4-5-18(15-26)24-11-13-25(14-12-24)20-7-3-2-6-19(20)22/h2-3,6-8,10,18H,4-5,9,11-16H2,1H3 |
| InChIKey | KJGZGLFUJSMAFV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |