C22H33N3O3 — CID 24791629
N-cyclohexyl-2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide (PubChem CID 24791629) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-cyclohexyl-2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 24791629 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | N-cyclohexyl-2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide |
| SMILES | CCOc1ccc(CN2CCNC(=O)C2CC(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H33N3O3/c1-3-28-19-11-9-17(10-12-19)16-25-14-13-23-22(27)20(25)15-21(26)24(2)18-7-5-4-6-8-18/h9-12,18,20H,3-8,13-16H2,1-2H3,(H,23,27) |
| InChIKey | PJWDILJELKDKID-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |