C18H19N5O7 — CID 24792203
N-[5-(4-methyl-2-nitrophenoxy)-2,4-dinitrophenyl]piperidin-1-amine (PubChem CID 24792203) has the molecular formula C18H19N5O7 and a molecular weight of 417.38 g/mol. Its IUPAC name is N-[5-(4-methyl-2-nitrophenoxy)-2,4-dinitrophenyl]piperidin-1-amine.
| Compound Name | N-[5-(4-methyl-2-nitrophenoxy)-2,4-dinitrophenyl]piperidin-1-amine |
|---|---|
| PubChem CID | 24792203 |
| Molecular Formula | C18H19N5O7 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[5-(4-methyl-2-nitrophenoxy)-2,4-dinitrophenyl]piperidin-1-amine |
| SMILES | Cc1ccc(Oc2cc(NN3CCCCC3)c([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N5O7/c1-12-5-6-17(15(9-12)22(26)27)30-18-10-13(19-20-7-3-2-4-8-20)14(21(24)25)11-16(18)23(28)29/h5-6,9-11,19H,2-4,7-8H2,1H3 |
| InChIKey | WBMOKROBRKIHSU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|