C18H14ClFN4O2S — CID 24792438
N-[2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-fluorophenyl)thiadiazole-4-carboxamide (PubChem CID 24792438) has the molecular formula C18H14ClFN4O2S and a molecular weight of 404.85 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-fluorophenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-fluorophenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 24792438 |
| Molecular Formula | C18H14ClFN4O2S |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-N-(3-chloro-4-fluorophenyl)thiadiazole-4-carboxamide |
| SMILES | O=C(CN(C(=O)c1csnn1)c1ccc(F)c(Cl)c1)NCc1ccccc1 |
| InChI | InChI=1S/C18H14ClFN4O2S/c19-14-8-13(6-7-15(14)20)24(18(26)16-11-27-23-22-16)10-17(25)21-9-12-4-2-1-3-5-12/h1-8,11H,9-10H2,(H,21,25) |
| InChIKey | DBCIZXBADKTBAK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |