C21H28O7 — CID 24796496
ethyl 2-[(1S,4R,4aR,9bS)-9b-(2-ethoxy-2-oxoethyl)-4-hydroxy-6-methoxy-2,3,4,4a-tetrahydro-1H-dibenzofuran-1-yl]acetate (PubChem CID 24796496) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl 2-[(1S,4R,4aR,9bS)-9b-(2-ethoxy-2-oxoethyl)-4-hydroxy-6-methoxy-2,3,4,4a-tetrahydro-1H-dibenzofuran-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,4R,4aR,9bS)-9b-(2-ethoxy-2-oxoethyl)-4-hydroxy-6-methoxy-2,3,4,4a-tetrahydro-1H-dibenzofuran-1-yl]acetate |
|---|---|
| PubChem CID | 24796496 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl 2-[(1S,4R,4aR,9bS)-9b-(2-ethoxy-2-oxoethyl)-4-hydroxy-6-methoxy-2,3,4,4a-tetrahydro-1H-dibenzofuran-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@@H](O)[C@@H]2Oc3c(OC)cccc3[C@]12CC(=O)OCC |
| InChI | InChI=1S/C21H28O7/c1-4-26-17(23)11-13-9-10-15(22)20-21(13,12-18(24)27-5-2)14-7-6-8-16(25-3)19(14)28-20/h6-8,13,15,20,22H,4-5,9-12H2,1-3H3/t13-,15+,20-,21-/m0/s1 |
| InChIKey | LNTTUJIPJUQEEI-GEOUXAIOSA-N |
| XLogP | 2.37 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |