C12H17NO2 — CID 82194434
4-ethyl-8-methoxy-2,3-dihydrochromen-4-amine (PubChem CID 82194434) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-ethyl-8-methoxy-2,3-dihydrochromen-4-amine.
| Compound Name | 4-ethyl-8-methoxy-2,3-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 82194434 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-ethyl-8-methoxy-2,3-dihydrochromen-4-amine |
| SMILES | CCC1(N)CCOc2c(OC)cccc21 |
| InChI | InChI=1S/C12H17NO2/c1-3-12(13)7-8-15-11-9(12)5-4-6-10(11)14-2/h4-6H,3,7-8,13H2,1-2H3 |
| InChIKey | TYSQVBITWJKXLJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |