C22H26O7 — CID 132573459
diethyl 2-[(1'R,4S)-8-methoxy-5'-oxospiro[2,3-dihydrochromene-4,2'-cyclohex-3-ene]-1'-yl]propanedioate (PubChem CID 132573459) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is diethyl 2-[(1'R,4S)-8-methoxy-5'-oxospiro[2,3-dihydrochromene-4,2'-cyclohex-3-ene]-1'-yl]propanedioate.
| Compound Name | diethyl 2-[(1'R,4S)-8-methoxy-5'-oxospiro[2,3-dihydrochromene-4,2'-cyclohex-3-ene]-1'-yl]propanedioate |
|---|---|
| PubChem CID | 132573459 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | diethyl 2-[(1'R,4S)-8-methoxy-5'-oxospiro[2,3-dihydrochromene-4,2'-cyclohex-3-ene]-1'-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H]1CC(=O)C=C[C@@]12CCOc1c(OC)cccc12 |
| InChI | InChI=1S/C22H26O7/c1-4-27-20(24)18(21(25)28-5-2)16-13-14(23)9-10-22(16)11-12-29-19-15(22)7-6-8-17(19)26-3/h6-10,16,18H,4-5,11-13H2,1-3H3/t16-,22+/m1/s1 |
| InChIKey | KNCFASNSFDOIIK-ZHRRBRCNSA-N |
| XLogP | 2.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|