C19H21NO6 — CID 68769787
3-ethoxy-6-methoxy-11-nitro-4-oxatetracyclo[7.7.1.01,12.05,17]heptadeca-5,7,9(17),15-tetraen-14-one (PubChem CID 68769787) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-ethoxy-6-methoxy-11-nitro-4-oxatetracyclo[7.7.1.01,12.05,17]heptadeca-5,7,9(17),15-tetraen-14-one.
| Compound Name | 3-ethoxy-6-methoxy-11-nitro-4-oxatetracyclo[7.7.1.01,12.05,17]heptadeca-5,7,9(17),15-tetraen-14-one |
|---|---|
| PubChem CID | 68769787 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-ethoxy-6-methoxy-11-nitro-4-oxatetracyclo[7.7.1.01,12.05,17]heptadeca-5,7,9(17),15-tetraen-14-one |
| SMILES | CCOC1CC23C=CC(=O)CC2C([N+](=O)[O-])Cc2ccc(OC)c(c23)O1 |
| InChI | InChI=1S/C19H21NO6/c1-3-25-16-10-19-7-6-12(21)9-13(19)14(20(22)23)8-11-4-5-15(24-2)18(26-16)17(11)19/h4-7,13-14,16H,3,8-10H2,1-2H3 |
| InChIKey | LLUKIJRMRPDERP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|