About 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine
4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine (PubChem CID 65419418) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine |
| PubChem CID | 65419418 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine |
| SMILES | COc1ccccc1CC1(N)CCOc2ccccc21 |
| InChI | InChI=1S/C17H19NO2/c1-19-15-8-4-2-6-13(15)12-17(18)10-11-20-16-9-5-3-7-14(16)17/h2-9H,10-12,18H2,1H3 |
| InChIKey | MEZGFCOFDIPVRF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine?
The IUPAC name of 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine (CID 65419418) is 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine.
What is the SMILES notation for 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine?
The canonical SMILES for 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine is COc1ccccc1CC1(N)CCOc2ccccc21.
What is the InChIKey of 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine?
The InChIKey is MEZGFCOFDIPVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-19-15-8-4-2-6-13(15)12-17(18)10-11-20-16-9-5-3-7-14(16)17/h2-9H,10-12,18H2,1H3.
What are the key properties of 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine?
4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine has a molecular weight of 269.34 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methoxyphenyl)methyl]-2,3-dihydrochromen-4-amine is sourced from PubChem (CID 65419418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).