About 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine
4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine (PubChem CID 65406283) has the molecular formula C16H19NOS
and a molecular weight of 273.40 g/mol. Its IUPAC name is 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine |
| PubChem CID | 65406283 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine |
| SMILES | CCc1ccc(CC2(N)CCOc3ccccc32)s1 |
| InChI | InChI=1S/C16H19NOS/c1-2-12-7-8-13(19-12)11-16(17)9-10-18-15-6-4-3-5-14(15)16/h3-8H,2,9-11,17H2,1H3 |
| InChIKey | IAVZVTDXXSFUSX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine?
The IUPAC name of 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine (CID 65406283) is 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine.
What is the SMILES notation for 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine?
The canonical SMILES for 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine is CCc1ccc(CC2(N)CCOc3ccccc32)s1.
What is the InChIKey of 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine?
The InChIKey is IAVZVTDXXSFUSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NOS/c1-2-12-7-8-13(19-12)11-16(17)9-10-18-15-6-4-3-5-14(15)16/h3-8H,2,9-11,17H2,1H3.
What are the key properties of 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine?
4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine has a molecular weight of 273.40 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-ethylthiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine is sourced from PubChem (CID 65406283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).