C14H14ClNOS — CID 65421588
4-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine (PubChem CID 65421588) has the molecular formula C14H14ClNOS and a molecular weight of 279.79 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 65421588 |
| Molecular Formula | C14H14ClNOS |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydrochromen-4-amine |
| SMILES | NC1(Cc2ccc(Cl)s2)CCOc2ccccc21 |
| InChI | InChI=1S/C14H14ClNOS/c15-13-6-5-10(18-13)9-14(16)7-8-17-12-4-2-1-3-11(12)14/h1-6H,7-9,16H2 |
| InChIKey | XEGACYHLCBWGBQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |