About [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate
[4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate (PubChem CID 24797877) has the molecular formula C12H11F3N4O2
and a molecular weight of 300.24 g/mol. Its IUPAC name is [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate |
| PubChem CID | 24797877 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc(-n2nnnc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3N4O2/c1-7(2)10(20)21-9-5-3-8(4-6-9)19-11(12(13,14)15)16-17-18-19/h3-7H,1-2H3 |
| InChIKey | SALPUFNIMSBBRD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate?
The IUPAC name of [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate (CID 24797877) is [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate.
What is the SMILES notation for [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate?
The canonical SMILES for [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate is CC(C)C(=O)Oc1ccc(-n2nnnc2C(F)(F)F)cc1.
What is the InChIKey of [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate?
The InChIKey is SALPUFNIMSBBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N4O2/c1-7(2)10(20)21-9-5-3-8(4-6-9)19-11(12(13,14)15)16-17-18-19/h3-7H,1-2H3.
What are the key properties of [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate?
[4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate has a molecular weight of 300.24 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(trifluoromethyl)tetrazol-1-yl]phenyl] 2-methylpropanoate is sourced from PubChem (CID 24797877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).