C17H12ClF3N4O2 — CID 54152245
[2-chloro-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl 4-methylbenzoate (PubChem CID 54152245) has the molecular formula C17H12ClF3N4O2 and a molecular weight of 396.76 g/mol. Its IUPAC name is [2-chloro-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl 4-methylbenzoate.
| Compound Name | [2-chloro-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 54152245 |
| Molecular Formula | C17H12ClF3N4O2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [2-chloro-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2cc(-n3nnnc3C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H12ClF3N4O2/c1-10-2-4-11(5-3-10)15(26)27-9-12-8-13(6-7-14(12)18)25-16(17(19,20)21)22-23-24-25/h2-8H,9H2,1H3 |
| InChIKey | OINWJASREORSNK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |