C16H18N2O2S2 — CID 24799249
10,13-dioxa-7,16-dithia-21,22-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene (PubChem CID 24799249) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 10,13-dioxa-7,16-dithia-21,22-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene.
| Compound Name | 10,13-dioxa-7,16-dithia-21,22-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene |
|---|---|
| PubChem CID | 24799249 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 10,13-dioxa-7,16-dithia-21,22-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene |
| SMILES | c1cc2nc(c1)-c1cccc(n1)SCCOCCOCCS2 |
| InChI | InChI=1S/C16H18N2O2S2/c1-3-13-14-4-2-6-16(18-14)22-12-10-20-8-7-19-9-11-21-15(5-1)17-13/h1-6H,7-12H2 |
| InChIKey | HRBMSRJNYDUCNT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |