C27H29N5O5 — CID 24799865
4-[[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-7-methoxychromen-2-one (PubChem CID 24799865) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 24799865 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 4-[[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-7-methoxychromen-2-one |
| SMILES | CCc1nc([N+](=O)[O-])c(N2CCN(Cc3cc(=O)oc4cc(OC)ccc34)CC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C27H29N5O5/c1-3-24-28-26(32(34)35)27(31(24)17-19-7-5-4-6-8-19)30-13-11-29(12-14-30)18-20-15-25(33)37-23-16-21(36-2)9-10-22(20)23/h4-10,15-16H,3,11-14,17-18H2,1-2H3 |
| InChIKey | KDTSENREEWTLNQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|