C29H31N7O5 — CID 122192420
7-[(2E)-2-[1-[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]-2-oxopropylidene]hydrazinyl]-4-methylchromen-2-one (PubChem CID 122192420) has the molecular formula C29H31N7O5 and a molecular weight of 557.61 g/mol. Its IUPAC name is 7-[(2E)-2-[1-[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]-2-oxopropylidene]hydrazinyl]-4-methylchromen-2-one.
| Compound Name | 7-[(2E)-2-[1-[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]-2-oxopropylidene]hydrazinyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 122192420 |
| Molecular Formula | C29H31N7O5 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 7-[(2E)-2-[1-[4-(3-benzyl-2-ethyl-5-nitroimidazol-4-yl)piperazin-1-yl]-2-oxopropylidene]hydrazinyl]-4-methylchromen-2-one |
| SMILES | CCc1nc([N+](=O)[O-])c(N2CCN(/C(=N/Nc3ccc4c(C)cc(=O)oc4c3)C(C)=O)CC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C29H31N7O5/c1-4-25-30-28(36(39)40)29(35(25)18-21-8-6-5-7-9-21)34-14-12-33(13-15-34)27(20(3)37)32-31-22-10-11-23-19(2)16-26(38)41-24(23)17-22/h5-11,16-17,31H,4,12-15,18H2,1-3H3/b32-27+ |
| InChIKey | UHUUSPUGNZSPMZ-QVAGMWBUSA-N |
| XLogP | 3.95 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|