C30H41ClN2O6 — CID 24800433
(2Z,4Z,6E,8S)-N-[(2S)-1-[[(1Z,6E)-7-chloro-4-oxoocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylnona-2,4,6-trienamide (PubChem CID 24800433) has the molecular formula C30H41ClN2O6 and a molecular weight of 561.12 g/mol. Its IUPAC name is (2Z,4Z,6E,8S)-N-[(2S)-1-[[(1Z,6E)-7-chloro-4-oxoocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylnona-2,4,6-trienamide.
| Compound Name | (2Z,4Z,6E,8S)-N-[(2S)-1-[[(1Z,6E)-7-chloro-4-oxoocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylnona-2,4,6-trienamide |
|---|---|
| PubChem CID | 24800433 |
| Molecular Formula | C30H41ClN2O6 |
| Molecular Weight | 561.12 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (2Z,4Z,6E,8S)-N-[(2S)-1-[[(1Z,6E)-7-chloro-4-oxoocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylnona-2,4,6-trienamide |
| SMILES | COC1=CCC([C@@H](C)/C=C(C)/C=C\C=C/C(=O)N[C@H](C(=O)N/C=C\CC(=O)C/C=C(\C)Cl)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C30H41ClN2O6/c1-20(19-21(2)24-16-17-25(38-7)29(37)39-24)11-8-9-13-26(35)33-27(30(4,5)6)28(36)32-18-10-12-23(34)15-14-22(3)31/h8-11,13-14,17-19,21,24,27H,12,15-16H2,1-7H3,(H,32,36)(H,33,35)/b11-8-,13-9-,18-10-,20-19+,22-14+/t21-,24?,27+/m0/s1 |
| InChIKey | UXIXXCZPXGYGHO-SXXIZZKXSA-N |
| XLogP | 5.18 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.12 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|